C16H25NO3SSi — CID 126819818
1,1-dioxo-N-[4-(2-trimethylsilylethyl)phenyl]thiolane-3-carboxamide (PubChem CID 126819818) has the molecular formula C16H25NO3SSi and a molecular weight of 339.53 g/mol. Its IUPAC name is 1,1-dioxo-N-[4-(2-trimethylsilylethyl)phenyl]thiolane-3-carboxamide.
| Compound Name | 1,1-dioxo-N-[4-(2-trimethylsilylethyl)phenyl]thiolane-3-carboxamide |
|---|---|
| PubChem CID | 126819818 |
| Molecular Formula | C16H25NO3SSi |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1,1-dioxo-N-[4-(2-trimethylsilylethyl)phenyl]thiolane-3-carboxamide |
| SMILES | C[Si](C)(C)CCc1ccc(NC(=O)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C16H25NO3SSi/c1-22(2,3)11-9-13-4-6-15(7-5-13)17-16(18)14-8-10-21(19,20)12-14/h4-7,14H,8-12H2,1-3H3,(H,17,18) |
| InChIKey | GGHYZNLKLYUZFS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|