C13H16N2O4S — CID 18089391
N-(3-acetamidophenyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 18089391) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(3-acetamidophenyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 18089391 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-(3-acetamidophenyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H16N2O4S/c1-9(16)14-11-3-2-4-12(7-11)15-13(17)10-5-6-20(18,19)8-10/h2-4,7,10H,5-6,8H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | BSIHKDDQRLGPSN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |