C12H14FNO3S — CID 9081263
(3R)-N-(3-fluoro-4-methylphenyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 9081263) has the molecular formula C12H14FNO3S and a molecular weight of 271.31 g/mol. Its IUPAC name is (3R)-N-(3-fluoro-4-methylphenyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3R)-N-(3-fluoro-4-methylphenyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 9081263 |
| Molecular Formula | C12H14FNO3S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | (3R)-N-(3-fluoro-4-methylphenyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2CCS(=O)(=O)C2)cc1F |
| InChI | InChI=1S/C12H14FNO3S/c1-8-2-3-10(6-11(8)13)14-12(15)9-4-5-18(16,17)7-9/h2-3,6,9H,4-5,7H2,1H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | BWLHYNYTNJRVBZ-VIFPVBQESA-N |
| XLogP | 1.51 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |