C14H19NO3S — CID 110857386
N-(3,4-dimethylphenyl)-1,1-dioxothiane-3-carboxamide (PubChem CID 110857386) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-1,1-dioxothiane-3-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-1,1-dioxothiane-3-carboxamide |
|---|---|
| PubChem CID | 110857386 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-(3,4-dimethylphenyl)-1,1-dioxothiane-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCCS(=O)(=O)C2)cc1C |
| InChI | InChI=1S/C14H19NO3S/c1-10-5-6-13(8-11(10)2)15-14(16)12-4-3-7-19(17,18)9-12/h5-6,8,12H,3-4,7,9H2,1-2H3,(H,15,16) |
| InChIKey | BJMYHTGHYXAKDV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |