C14H17NO4S — CID 110861051
N-(3-acetylphenyl)-1,1-dioxothiane-3-carboxamide (PubChem CID 110861051) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is N-(3-acetylphenyl)-1,1-dioxothiane-3-carboxamide.
| Compound Name | N-(3-acetylphenyl)-1,1-dioxothiane-3-carboxamide |
|---|---|
| PubChem CID | 110861051 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-(3-acetylphenyl)-1,1-dioxothiane-3-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C2CCCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H17NO4S/c1-10(16)11-4-2-6-13(8-11)15-14(17)12-5-3-7-20(18,19)9-12/h2,4,6,8,12H,3,5,7,9H2,1H3,(H,15,17) |
| InChIKey | KBYSGJRLCFXRDF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |