C18H21NO3 — CID 50986057
(1S,5S)-N-(3-acetylphenyl)-9-oxobicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 50986057) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (1S,5S)-N-(3-acetylphenyl)-9-oxobicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | (1S,5S)-N-(3-acetylphenyl)-9-oxobicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 50986057 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (1S,5S)-N-(3-acetylphenyl)-9-oxobicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C2C[C@@H]3CCC[C@@H](C2)C3=O)c1 |
| InChI | InChI=1S/C18H21NO3/c1-11(20)12-4-3-7-16(10-12)19-18(22)15-8-13-5-2-6-14(9-15)17(13)21/h3-4,7,10,13-15H,2,5-6,8-9H2,1H3,(H,19,22)/t13-,14-/m0/s1 |
| InChIKey | UBDDETFAQFJXAV-KBPBESRZSA-N |
| XLogP | 3.22 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |