C18H23NO2 — CID 17434309
N-(3,4-dimethylphenyl)-9-oxobicyclo[3.3.1]nonane-3-carboxamide (PubChem CID 17434309) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-9-oxobicyclo[3.3.1]nonane-3-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-9-oxobicyclo[3.3.1]nonane-3-carboxamide |
|---|---|
| PubChem CID | 17434309 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-(3,4-dimethylphenyl)-9-oxobicyclo[3.3.1]nonane-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC3CCCC(C2)C3=O)cc1C |
| InChI | InChI=1S/C18H23NO2/c1-11-6-7-16(8-12(11)2)19-18(21)15-9-13-4-3-5-14(10-15)17(13)20/h6-8,13-15H,3-5,9-10H2,1-2H3,(H,19,21) |
| InChIKey | AWTRJMIZDOJXNX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |