C15H21NO3S — CID 110858216
1,1-dioxo-N-(2,4,6-trimethylphenyl)thiane-3-carboxamide (PubChem CID 110858216) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 1,1-dioxo-N-(2,4,6-trimethylphenyl)thiane-3-carboxamide.
| Compound Name | 1,1-dioxo-N-(2,4,6-trimethylphenyl)thiane-3-carboxamide |
|---|---|
| PubChem CID | 110858216 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1,1-dioxo-N-(2,4,6-trimethylphenyl)thiane-3-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C2CCCS(=O)(=O)C2)c(C)c1 |
| InChI | InChI=1S/C15H21NO3S/c1-10-7-11(2)14(12(3)8-10)16-15(17)13-5-4-6-20(18,19)9-13/h7-8,13H,4-6,9H2,1-3H3,(H,16,17) |
| InChIKey | GRZPOAIUTSVBLB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |