C11H13ClN2O3S — CID 103696096
N-(2-chloro-4-methyl-3-pyridinyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 103696096) has the molecular formula C11H13ClN2O3S and a molecular weight of 288.76 g/mol. Its IUPAC name is N-(2-chloro-4-methyl-3-pyridinyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(2-chloro-4-methyl-3-pyridinyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 103696096 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | N-(2-chloro-4-methyl-3-pyridinyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | Cc1ccnc(Cl)c1NC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13ClN2O3S/c1-7-2-4-13-10(12)9(7)14-11(15)8-3-5-18(16,17)6-8/h2,4,8H,3,5-6H2,1H3,(H,14,15) |
| InChIKey | SYRVJLSUMWHYDK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|