C10H11BrN2O4S — CID 167875557
N-(4-bromo-3-hydroxy-2-pyridinyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 167875557) has the molecular formula C10H11BrN2O4S and a molecular weight of 335.18 g/mol. Its IUPAC name is N-(4-bromo-3-hydroxy-2-pyridinyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(4-bromo-3-hydroxy-2-pyridinyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 167875557 |
| Molecular Formula | C10H11BrN2O4S |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | N-(4-bromo-3-hydroxy-2-pyridinyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(Nc1nccc(Br)c1O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H11BrN2O4S/c11-7-1-3-12-9(8(7)14)13-10(15)6-2-4-18(16,17)5-6/h1,3,6,14H,2,4-5H2,(H,12,13,15) |
| InChIKey | FRBUYKMJJAYLEM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |