C10H13N3O3S — CID 64913582
N-(3-amino-4-pyridinyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 64913582) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is N-(3-amino-4-pyridinyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(3-amino-4-pyridinyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 64913582 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N-(3-amino-4-pyridinyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | Nc1cnccc1NC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H13N3O3S/c11-8-5-12-3-1-9(8)13-10(14)7-2-4-17(15,16)6-7/h1,3,5,7H,2,4,6,11H2,(H,12,13,14) |
| InChIKey | BLMHRFAKPMDIQG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |