C12H12N2O3S — CID 60674718
N-(2-cyanophenyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 60674718) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is N-(2-cyanophenyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(2-cyanophenyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 60674718 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | N-(2-cyanophenyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H12N2O3S/c13-7-9-3-1-2-4-11(9)14-12(15)10-5-6-18(16,17)8-10/h1-4,10H,5-6,8H2,(H,14,15) |
| InChIKey | NBTJIVGODSYXGN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |