C21H21N3O2 — CID 109150350
4-N-(2-cyanophenyl)-1-N-phenylcyclohexane-1,4-dicarboxamide (PubChem CID 109150350) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-N-(2-cyanophenyl)-1-N-phenylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(2-cyanophenyl)-1-N-phenylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109150350 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 4-N-(2-cyanophenyl)-1-N-phenylcyclohexane-1,4-dicarboxamide |
| SMILES | N#Cc1ccccc1NC(=O)C1CCC(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C21H21N3O2/c22-14-17-6-4-5-9-19(17)24-21(26)16-12-10-15(11-13-16)20(25)23-18-7-2-1-3-8-18/h1-9,15-16H,10-13H2,(H,23,25)(H,24,26) |
| InChIKey | MFQAIAHPTRZHPU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |