C22H22ClN3O2 — CID 109148526
1-N-[(4-chlorophenyl)methyl]-4-N-(2-cyanophenyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109148526) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is 1-N-[(4-chlorophenyl)methyl]-4-N-(2-cyanophenyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N-[(4-chlorophenyl)methyl]-4-N-(2-cyanophenyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109148526 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-N-[(4-chlorophenyl)methyl]-4-N-(2-cyanophenyl)cyclohexane-1,4-dicarboxamide |
| SMILES | N#Cc1ccccc1NC(=O)C1CCC(C(=O)NCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H22ClN3O2/c23-19-11-5-15(6-12-19)14-25-21(27)16-7-9-17(10-8-16)22(28)26-20-4-2-1-3-18(20)13-24/h1-6,11-12,16-17H,7-10,14H2,(H,25,27)(H,26,28) |
| InChIKey | PCCWUSNOTFRRJO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |