C15H12ClN3O — CID 108899194
1-[(4-chlorophenyl)methyl]-3-(2-cyanophenyl)urea (PubChem CID 108899194) has the molecular formula C15H12ClN3O and a molecular weight of 285.73 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(2-cyanophenyl)urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(2-cyanophenyl)urea |
|---|---|
| PubChem CID | 108899194 |
| Molecular Formula | C15H12ClN3O |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(2-cyanophenyl)urea |
| SMILES | N#Cc1ccccc1NC(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12ClN3O/c16-13-7-5-11(6-8-13)10-18-15(20)19-14-4-2-1-3-12(14)9-17/h1-8H,10H2,(H2,18,19,20) |
| InChIKey | XFOKIUOSBSNGNG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |