About N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide
N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide (PubChem CID 108501543) has the molecular formula C15H10ClN3O2
and a molecular weight of 299.72 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide |
| PubChem CID | 108501543 |
| Molecular Formula | C15H10ClN3O2 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide |
| SMILES | N#Cc1ccccc1NC(=O)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H10ClN3O2/c16-11-5-7-12(8-6-11)18-14(20)15(21)19-13-4-2-1-3-10(13)9-17/h1-8H,(H,18,20)(H,19,21) |
| InChIKey | FXMKFBHINOJJEA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide?
The IUPAC name of N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide (CID 108501543) is N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide.
What is the SMILES notation for N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide?
The canonical SMILES for N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide is N#Cc1ccccc1NC(=O)C(=O)Nc1ccc(Cl)cc1.
What is the InChIKey of N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide?
The InChIKey is FXMKFBHINOJJEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClN3O2/c16-11-5-7-12(8-6-11)18-14(20)15(21)19-13-4-2-1-3-10(13)9-17/h1-8H,(H,18,20)(H,19,21).
What are the key properties of N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide?
N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide has a molecular weight of 299.72 g/mol, XLogP of 2.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-N'-(2-cyanophenyl)oxamide is sourced from PubChem (CID 108501543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).