About (2-cyanophenyl)urea
(2-cyanophenyl)urea (PubChem CID 13155570) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is (2-cyanophenyl)urea.
Molecular Properties
| Compound Name | (2-cyanophenyl)urea |
| PubChem CID | 13155570 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | (2-cyanophenyl)urea |
| SMILES | N#Cc1ccccc1NC(N)=O |
| InChI | InChI=1S/C8H7N3O/c9-5-6-3-1-2-4-7(6)11-8(10)12/h1-4H,(H3,10,11,12) |
| InChIKey | QUAYEHVOVRZTOO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-cyanophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyanophenyl)urea?
The IUPAC name of (2-cyanophenyl)urea (CID 13155570) is (2-cyanophenyl)urea.
What is the SMILES notation for (2-cyanophenyl)urea?
The canonical SMILES for (2-cyanophenyl)urea is N#Cc1ccccc1NC(N)=O.
What is the InChIKey of (2-cyanophenyl)urea?
The InChIKey is QUAYEHVOVRZTOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c9-5-6-3-1-2-4-7(6)11-8(10)12/h1-4H,(H3,10,11,12).
What are the key properties of (2-cyanophenyl)urea?
(2-cyanophenyl)urea has a molecular weight of 161.16 g/mol, XLogP of 1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl)urea is sourced from PubChem (CID 13155570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).