About N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide
N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide (PubChem CID 108501638) has the molecular formula C16H12N4O3
and a molecular weight of 308.30 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide.
Molecular Properties
| Compound Name | N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide |
| PubChem CID | 108501638 |
| Molecular Formula | C16H12N4O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide |
| SMILES | N#Cc1ccccc1NC(=O)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C16H12N4O3/c17-9-11-3-1-2-4-13(11)20-16(23)15(22)19-12-7-5-10(6-8-12)14(18)21/h1-8H,(H2,18,21)(H,19,22)(H,20,23) |
| InChIKey | BPLJXHFANKLYGP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide?
The IUPAC name of N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide (CID 108501638) is N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide.
What is the SMILES notation for N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide?
The canonical SMILES for N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide is N#Cc1ccccc1NC(=O)C(=O)Nc1ccc(C(N)=O)cc1.
What is the InChIKey of N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide?
The InChIKey is BPLJXHFANKLYGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O3/c17-9-11-3-1-2-4-13(11)20-16(23)15(22)19-12-7-5-10(6-8-12)14(18)21/h1-8H,(H2,18,21)(H,19,22)(H,20,23).
What are the key properties of N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide?
N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide has a molecular weight of 308.30 g/mol, XLogP of 1.23, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-carbamoylphenyl)-N'-(2-cyanophenyl)oxamide is sourced from PubChem (CID 108501638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).