C18H17N3O2 — CID 108501524
N-(2-cyanophenyl)-N'-(2,4,6-trimethylphenyl)oxamide (PubChem CID 108501524) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-(2-cyanophenyl)-N'-(2,4,6-trimethylphenyl)oxamide.
| Compound Name | N-(2-cyanophenyl)-N'-(2,4,6-trimethylphenyl)oxamide |
|---|---|
| PubChem CID | 108501524 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-(2-cyanophenyl)-N'-(2,4,6-trimethylphenyl)oxamide |
| SMILES | Cc1cc(C)c(NC(=O)C(=O)Nc2ccccc2C#N)c(C)c1 |
| InChI | InChI=1S/C18H17N3O2/c1-11-8-12(2)16(13(3)9-11)21-18(23)17(22)20-15-7-5-4-6-14(15)10-19/h4-9H,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | KSJPVSMOCRMJOR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|