C18H16ClN3O2 — CID 108955380
N'-(2-chloro-4,6-dimethylphenyl)-N-(2-cyanophenyl)propanediamide (PubChem CID 108955380) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is N'-(2-chloro-4,6-dimethylphenyl)-N-(2-cyanophenyl)propanediamide.
| Compound Name | N'-(2-chloro-4,6-dimethylphenyl)-N-(2-cyanophenyl)propanediamide |
|---|---|
| PubChem CID | 108955380 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N'-(2-chloro-4,6-dimethylphenyl)-N-(2-cyanophenyl)propanediamide |
| SMILES | Cc1cc(C)c(NC(=O)CC(=O)Nc2ccccc2C#N)c(Cl)c1 |
| InChI | InChI=1S/C18H16ClN3O2/c1-11-7-12(2)18(14(19)8-11)22-17(24)9-16(23)21-15-6-4-3-5-13(15)10-20/h3-8H,9H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | ZGBMIIGNLAQUOE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|