C16H12ClN3O2 — CID 108955002
N-(3-chlorophenyl)-N'-(2-cyanophenyl)propanediamide (PubChem CID 108955002) has the molecular formula C16H12ClN3O2 and a molecular weight of 313.74 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N'-(2-cyanophenyl)propanediamide.
| Compound Name | N-(3-chlorophenyl)-N'-(2-cyanophenyl)propanediamide |
|---|---|
| PubChem CID | 108955002 |
| Molecular Formula | C16H12ClN3O2 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-(3-chlorophenyl)-N'-(2-cyanophenyl)propanediamide |
| SMILES | N#Cc1ccccc1NC(=O)CC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H12ClN3O2/c17-12-5-3-6-13(8-12)19-15(21)9-16(22)20-14-7-2-1-4-11(14)10-18/h1-8H,9H2,(H,19,21)(H,20,22) |
| InChIKey | YPHAECYXTBSRJR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|