C17H13N3O4 — CID 108956697
N-(1,3-benzodioxol-5-yl)-N'-(2-cyanophenyl)propanediamide (PubChem CID 108956697) has the molecular formula C17H13N3O4 and a molecular weight of 323.31 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-(2-cyanophenyl)propanediamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-(2-cyanophenyl)propanediamide |
|---|---|
| PubChem CID | 108956697 |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-(2-cyanophenyl)propanediamide |
| SMILES | N#Cc1ccccc1NC(=O)CC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H13N3O4/c18-9-11-3-1-2-4-13(11)20-17(22)8-16(21)19-12-5-6-14-15(7-12)24-10-23-14/h1-7H,8,10H2,(H,19,21)(H,20,22) |
| InChIKey | VLFYFGAYFAEFJI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|