C16H13N3O3 — CID 109010915
N-(1,3-benzodioxol-5-yl)-2-(2-cyanoanilino)acetamide (PubChem CID 109010915) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(2-cyanoanilino)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(2-cyanoanilino)acetamide |
|---|---|
| PubChem CID | 109010915 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(2-cyanoanilino)acetamide |
| SMILES | N#Cc1ccccc1NCC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13N3O3/c17-8-11-3-1-2-4-13(11)18-9-16(20)19-12-5-6-14-15(7-12)22-10-21-14/h1-7,18H,9-10H2,(H,19,20) |
| InChIKey | CWXVYFIMDFPNQN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |