C21H18N4O5 — CID 17407591
2-(2-anilino-5-nitroanilino)-N-(1,3-benzodioxol-5-yl)acetamide (PubChem CID 17407591) has the molecular formula C21H18N4O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is 2-(2-anilino-5-nitroanilino)-N-(1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2-(2-anilino-5-nitroanilino)-N-(1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 17407591 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-(2-anilino-5-nitroanilino)-N-(1,3-benzodioxol-5-yl)acetamide |
| SMILES | O=C(CNc1cc([N+](=O)[O-])ccc1Nc1ccccc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H18N4O5/c26-21(24-15-6-9-19-20(10-15)30-13-29-19)12-22-18-11-16(25(27)28)7-8-17(18)23-14-4-2-1-3-5-14/h1-11,22-23H,12-13H2,(H,24,26) |
| InChIKey | SMSOSTQWEVRLMH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|