C24H26N4O3 — CID 9106654
2-(2-anilino-5-nitroanilino)-N-(2,6-diethylphenyl)acetamide (PubChem CID 9106654) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-(2-anilino-5-nitroanilino)-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-(2-anilino-5-nitroanilino)-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 9106654 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-(2-anilino-5-nitroanilino)-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CNc1cc([N+](=O)[O-])ccc1Nc1ccccc1 |
| InChI | InChI=1S/C24H26N4O3/c1-3-17-9-8-10-18(4-2)24(17)27-23(29)16-25-22-15-20(28(30)31)13-14-21(22)26-19-11-6-5-7-12-19/h5-15,25-26H,3-4,16H2,1-2H3,(H,27,29) |
| InChIKey | RZSNFLAROPHPPS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|