C21H18N2O4 — CID 109010719
N-(1,3-benzodioxol-5-yl)-2-(4-phenoxyanilino)acetamide (PubChem CID 109010719) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(4-phenoxyanilino)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(4-phenoxyanilino)acetamide |
|---|---|
| PubChem CID | 109010719 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(4-phenoxyanilino)acetamide |
| SMILES | O=C(CNc1ccc(Oc2ccccc2)cc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H18N2O4/c24-21(23-16-8-11-19-20(12-16)26-14-25-19)13-22-15-6-9-18(10-7-15)27-17-4-2-1-3-5-17/h1-12,22H,13-14H2,(H,23,24) |
| InChIKey | OOGASLOTLIPTPK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |