C23H19NO4 — CID 113198960
1-(1,3-benzodioxol-5-yl)-N-(4-phenoxyphenyl)cyclopropane-1-carboxamide (PubChem CID 113198960) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-(4-phenoxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-(4-phenoxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 113198960 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-(4-phenoxyphenyl)cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)C1(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C23H19NO4/c25-22(23(12-13-23)16-6-11-20-21(14-16)27-15-26-20)24-17-7-9-19(10-8-17)28-18-4-2-1-3-5-18/h1-11,14H,12-13,15H2,(H,24,25) |
| InChIKey | MQMDSQRBZRGUMF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |