C20H19NO5 — CID 113198969
ethyl 4-[[1-(1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]benzoate (PubChem CID 113198969) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is ethyl 4-[[1-(1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[1-(1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 113198969 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | ethyl 4-[[1-(1,3-benzodioxol-5-yl)cyclopropanecarbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2(c3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C20H19NO5/c1-2-24-18(22)13-3-6-15(7-4-13)21-19(23)20(9-10-20)14-5-8-16-17(11-14)26-12-25-16/h3-8,11H,2,9-10,12H2,1H3,(H,21,23) |
| InChIKey | CRYXDUBOBHNMOG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |