C19H20N2O5 — CID 109042295
ethyl 4-[3-(1,3-benzodioxol-5-ylamino)propanoylamino]benzoate (PubChem CID 109042295) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is ethyl 4-[3-(1,3-benzodioxol-5-ylamino)propanoylamino]benzoate.
| Compound Name | ethyl 4-[3-(1,3-benzodioxol-5-ylamino)propanoylamino]benzoate |
|---|---|
| PubChem CID | 109042295 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | ethyl 4-[3-(1,3-benzodioxol-5-ylamino)propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCNc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H20N2O5/c1-2-24-19(23)13-3-5-14(6-4-13)21-18(22)9-10-20-15-7-8-16-17(11-15)26-12-25-16/h3-8,11,20H,2,9-10,12H2,1H3,(H,21,22) |
| InChIKey | KZIDRDYDHHKKGA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|