C21H26N4O3 — CID 109041927
3-(1,3-benzodioxol-5-ylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]propanamide (PubChem CID 109041927) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 109041927 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylamino)-N-[4-(4-methylpiperazin-1-yl)phenyl]propanamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CCNc3ccc4c(c3)OCO4)cc2)CC1 |
| InChI | InChI=1S/C21H26N4O3/c1-24-10-12-25(13-11-24)18-5-2-16(3-6-18)23-21(26)8-9-22-17-4-7-19-20(14-17)28-15-27-19/h2-7,14,22H,8-13,15H2,1H3,(H,23,26) |
| InChIKey | ABMGRNNJPHDYCQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|