C22H27N3O3 — CID 17421203
3-(1,3-benzodioxol-5-yl)-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide (PubChem CID 17421203) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 17421203 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[4-(4-ethylpiperazin-1-yl)phenyl]propanamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CCc3ccc4c(c3)OCO4)cc2)CC1 |
| InChI | InChI=1S/C22H27N3O3/c1-2-24-11-13-25(14-12-24)19-7-5-18(6-8-19)23-22(26)10-4-17-3-9-20-21(15-17)28-16-27-20/h3,5-9,15H,2,4,10-14,16H2,1H3,(H,23,26) |
| InChIKey | SQAKUYABVKLUEX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|