About N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide
N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide (PubChem CID 108954791) has the molecular formula C16H12FN3O2
and a molecular weight of 297.29 g/mol. Its IUPAC name is N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide.
Molecular Properties
| Compound Name | N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide |
| PubChem CID | 108954791 |
| Molecular Formula | C16H12FN3O2 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide |
| SMILES | N#Cc1ccccc1NC(=O)CC(=O)Nc1ccccc1F |
| InChI | InChI=1S/C16H12FN3O2/c17-12-6-2-4-8-14(12)20-16(22)9-15(21)19-13-7-3-1-5-11(13)10-18/h1-8H,9H2,(H,19,21)(H,20,22) |
| InChIKey | SEWYKYBPJGZXJP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide?
The IUPAC name of N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide (CID 108954791) is N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide.
What is the SMILES notation for N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide?
The canonical SMILES for N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide is N#Cc1ccccc1NC(=O)CC(=O)Nc1ccccc1F.
What is the InChIKey of N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide?
The InChIKey is SEWYKYBPJGZXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12FN3O2/c17-12-6-2-4-8-14(12)20-16(22)9-15(21)19-13-7-3-1-5-11(13)10-18/h1-8H,9H2,(H,19,21)(H,20,22).
What are the key properties of N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide?
N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide has a molecular weight of 297.29 g/mol, XLogP of 2.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanophenyl)-N'-(2-fluorophenyl)propanediamide is sourced from PubChem (CID 108954791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).