C15H10F3N3O — CID 30716981
N-(2-cyanophenyl)-2-(2,3,4-trifluoroanilino)acetamide (PubChem CID 30716981) has the molecular formula C15H10F3N3O and a molecular weight of 305.26 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-(2,3,4-trifluoroanilino)acetamide.
| Compound Name | N-(2-cyanophenyl)-2-(2,3,4-trifluoroanilino)acetamide |
|---|---|
| PubChem CID | 30716981 |
| Molecular Formula | C15H10F3N3O |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-(2-cyanophenyl)-2-(2,3,4-trifluoroanilino)acetamide |
| SMILES | N#Cc1ccccc1NC(=O)CNc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H10F3N3O/c16-10-5-6-12(15(18)14(10)17)20-8-13(22)21-11-4-2-1-3-9(11)7-19/h1-6,20H,8H2,(H,21,22) |
| InChIKey | JVDUTAVRXKQVMU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|