C16H11F3N2OS — CID 8967350
2-[(2-cyanophenyl)methylsulfanyl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 8967350) has the molecular formula C16H11F3N2OS and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-[(2-cyanophenyl)methylsulfanyl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(2-cyanophenyl)methylsulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 8967350 |
| Molecular Formula | C16H11F3N2OS |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 2-[(2-cyanophenyl)methylsulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | N#Cc1ccccc1CSCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H11F3N2OS/c17-12-5-6-13(16(19)15(12)18)21-14(22)9-23-8-11-4-2-1-3-10(11)7-20/h1-6H,8-9H2,(H,21,22) |
| InChIKey | POEJWBIBQMFTBK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|