C17H14F2N2O2S — CID 8967517
2-[(2-cyanophenyl)methylsulfanyl]-N-[4-(difluoromethoxy)phenyl]acetamide (PubChem CID 8967517) has the molecular formula C17H14F2N2O2S and a molecular weight of 348.37 g/mol. Its IUPAC name is 2-[(2-cyanophenyl)methylsulfanyl]-N-[4-(difluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(2-cyanophenyl)methylsulfanyl]-N-[4-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 8967517 |
| Molecular Formula | C17H14F2N2O2S |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-[(2-cyanophenyl)methylsulfanyl]-N-[4-(difluoromethoxy)phenyl]acetamide |
| SMILES | N#Cc1ccccc1CSCC(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H14F2N2O2S/c18-17(19)23-15-7-5-14(6-8-15)21-16(22)11-24-10-13-4-2-1-3-12(13)9-20/h1-8,17H,10-11H2,(H,21,22) |
| InChIKey | DTVPUXHYARBKKI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |