C17H13N3OS — CID 8967300
N-(3-cyanophenyl)-2-[(2-cyanophenyl)methylsulfanyl]acetamide (PubChem CID 8967300) has the molecular formula C17H13N3OS and a molecular weight of 307.38 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[(2-cyanophenyl)methylsulfanyl]acetamide.
| Compound Name | N-(3-cyanophenyl)-2-[(2-cyanophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 8967300 |
| Molecular Formula | C17H13N3OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(3-cyanophenyl)-2-[(2-cyanophenyl)methylsulfanyl]acetamide |
| SMILES | N#Cc1cccc(NC(=O)CSCc2ccccc2C#N)c1 |
| InChI | InChI=1S/C17H13N3OS/c18-9-13-4-3-7-16(8-13)20-17(21)12-22-11-15-6-2-1-5-14(15)10-19/h1-8H,11-12H2,(H,20,21) |
| InChIKey | VDMCWSQSFSBOPK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |