C20H21N3O3S2 — CID 8967393
2-[(2-cyanophenyl)methylsulfanyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 8967393) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-[(2-cyanophenyl)methylsulfanyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(2-cyanophenyl)methylsulfanyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 8967393 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 2-[(2-cyanophenyl)methylsulfanyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | N#Cc1ccccc1CSCC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H21N3O3S2/c21-13-16-6-1-2-7-17(16)14-27-15-20(24)22-18-8-5-9-19(12-18)28(25,26)23-10-3-4-11-23/h1-2,5-9,12H,3-4,10-11,14-15H2,(H,22,24) |
| InChIKey | SEWXHHJAENBHHI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |