C19H21BrN2O3S2 — CID 112781729
2-[(4-bromophenyl)methylsulfanyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 112781729) has the molecular formula C19H21BrN2O3S2 and a molecular weight of 469.43 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfanyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(4-bromophenyl)methylsulfanyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 112781729 |
| Molecular Formula | C19H21BrN2O3S2 |
| Molecular Weight | 469.43 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfanyl]-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CSCc1ccc(Br)cc1)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C19H21BrN2O3S2/c20-16-8-6-15(7-9-16)13-26-14-19(23)21-17-4-3-5-18(12-17)27(24,25)22-10-1-2-11-22/h3-9,12H,1-2,10-11,13-14H2,(H,21,23) |
| InChIKey | XNZPQBWURSEXSJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |