C11H10F3NO3S — CID 43237288
3-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]sulfanylpropanoic acid (PubChem CID 43237288) has the molecular formula C11H10F3NO3S and a molecular weight of 293.27 g/mol. Its IUPAC name is 3-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]sulfanylpropanoic acid.
| Compound Name | 3-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43237288 |
| Molecular Formula | C11H10F3NO3S |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 3-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]sulfanylpropanoic acid |
| SMILES | O=C(O)CCSCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H10F3NO3S/c12-6-1-2-7(11(14)10(6)13)15-8(16)5-19-4-3-9(17)18/h1-2H,3-5H2,(H,15,16)(H,17,18) |
| InChIKey | BCZYKVAYBHYWER-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|