C12H10F3N5OS — CID 3627095
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 3627095) has the molecular formula C12H10F3N5OS and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 3627095 |
| Molecular Formula | C12H10F3N5OS |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Nc1cc(N)nc(SCC(=O)Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C12H10F3N5OS/c13-5-1-2-6(11(15)10(5)14)18-9(21)4-22-12-19-7(16)3-8(17)20-12/h1-3H,4H2,(H,18,21)(H4,16,17,19,20) |
| InChIKey | UAYPVRFUFZAYCG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|