C12H9ClFN3OS — CID 743539
N-(4-chloro-2-fluorophenyl)-2-pyrimidin-2-ylsulfanylacetamide (PubChem CID 743539) has the molecular formula C12H9ClFN3OS and a molecular weight of 297.74 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-pyrimidin-2-ylsulfanylacetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-pyrimidin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 743539 |
| Molecular Formula | C12H9ClFN3OS |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-pyrimidin-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1ncccn1)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H9ClFN3OS/c13-8-2-3-10(9(14)6-8)17-11(18)7-19-12-15-4-1-5-16-12/h1-6H,7H2,(H,17,18) |
| InChIKey | HFEDHKYHVLSVIO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |