C16H11F2N3OS — CID 5142642
N-(2,4-difluorophenyl)-2-quinazolin-2-ylsulfanylacetamide (PubChem CID 5142642) has the molecular formula C16H11F2N3OS and a molecular weight of 331.35 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-quinazolin-2-ylsulfanylacetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-quinazolin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 5142642 |
| Molecular Formula | C16H11F2N3OS |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-quinazolin-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1ncc2ccccc2n1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H11F2N3OS/c17-11-5-6-14(12(18)7-11)20-15(22)9-23-16-19-8-10-3-1-2-4-13(10)21-16/h1-8H,9H2,(H,20,22) |
| InChIKey | IFZYBNXMXKCZBN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |