C22H15F2N3O2S — CID 4673947
N-(2,4-difluorophenyl)-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide (PubChem CID 4673947) has the molecular formula C22H15F2N3O2S and a molecular weight of 423.44 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 4673947 |
| Molecular Formula | C22H15F2N3O2S |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(4-oxo-3-phenylquinazolin-2-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1-c1ccccc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C22H15F2N3O2S/c23-14-10-11-19(17(24)12-14)25-20(28)13-30-22-26-18-9-5-4-8-16(18)21(29)27(22)15-6-2-1-3-7-15/h1-12H,13H2,(H,25,28) |
| InChIKey | GOQIVOSGLAIMSP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |