C19H17F2N3O2S — CID 9329888
N-(2,4-difluorophenyl)-2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide (PubChem CID 9329888) has the molecular formula C19H17F2N3O2S and a molecular weight of 389.43 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 9329888 |
| Molecular Formula | C19H17F2N3O2S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(4-oxo-3-propylquinazolin-2-yl)sulfanylacetamide |
| SMILES | CCCn1c(SCC(=O)Nc2ccc(F)cc2F)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H17F2N3O2S/c1-2-9-24-18(26)13-5-3-4-6-15(13)23-19(24)27-11-17(25)22-16-8-7-12(20)10-14(16)21/h3-8,10H,2,9,11H2,1H3,(H,22,25) |
| InChIKey | UBNIGLIWDYGNCM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |