C18H16F2N2OS — CID 51365343
2-[(2,4-difluorophenyl)methylsulfanyl]-3-propylquinazolin-4-one (PubChem CID 51365343) has the molecular formula C18H16F2N2OS and a molecular weight of 346.40 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)methylsulfanyl]-3-propylquinazolin-4-one.
| Compound Name | 2-[(2,4-difluorophenyl)methylsulfanyl]-3-propylquinazolin-4-one |
|---|---|
| PubChem CID | 51365343 |
| Molecular Formula | C18H16F2N2OS |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[(2,4-difluorophenyl)methylsulfanyl]-3-propylquinazolin-4-one |
| SMILES | CCCn1c(SCc2ccc(F)cc2F)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H16F2N2OS/c1-2-9-22-17(23)14-5-3-4-6-16(14)21-18(22)24-11-12-7-8-13(19)10-15(12)20/h3-8,10H,2,9,11H2,1H3 |
| InChIKey | MWDHEFNSRVURGI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |