C23H22ClFN2OS — CID 5158913
2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3-[2-(cyclohexen-1-yl)ethyl]quinazolin-4-one (PubChem CID 5158913) has the molecular formula C23H22ClFN2OS and a molecular weight of 428.96 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3-[2-(cyclohexen-1-yl)ethyl]quinazolin-4-one.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3-[2-(cyclohexen-1-yl)ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 5158913 |
| Molecular Formula | C23H22ClFN2OS |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-3-[2-(cyclohexen-1-yl)ethyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCc2ccc(F)cc2Cl)n1CCC1=CCCCC1 |
| InChI | InChI=1S/C23H22ClFN2OS/c24-20-14-18(25)11-10-17(20)15-29-23-26-21-9-5-4-8-19(21)22(28)27(23)13-12-16-6-2-1-3-7-16/h4-6,8-11,14H,1-3,7,12-13,15H2 |
| InChIKey | PPVGAKAPILBZDW-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|