C25H26N2O3S — CID 16544630
3-[2-(cyclohexen-1-yl)ethyl]-2-[2-(2-methoxyphenyl)-2-oxoethyl]sulfanylquinazolin-4-one (PubChem CID 16544630) has the molecular formula C25H26N2O3S and a molecular weight of 434.56 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyl]-2-[2-(2-methoxyphenyl)-2-oxoethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyl]-2-[2-(2-methoxyphenyl)-2-oxoethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 16544630 |
| Molecular Formula | C25H26N2O3S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyl]-2-[2-(2-methoxyphenyl)-2-oxoethyl]sulfanylquinazolin-4-one |
| SMILES | COc1ccccc1C(=O)CSc1nc2ccccc2c(=O)n1CCC1=CCCCC1 |
| InChI | InChI=1S/C25H26N2O3S/c1-30-23-14-8-6-12-20(23)22(28)17-31-25-26-21-13-7-5-11-19(21)24(29)27(25)16-15-18-9-3-2-4-10-18/h5-9,11-14H,2-4,10,15-17H2,1H3 |
| InChIKey | BAECZJBNZUIWST-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|