C24H22F3N3O2S — CID 4233306
2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 4233306) has the molecular formula C24H22F3N3O2S and a molecular weight of 473.52 g/mol. Its IUPAC name is 2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 4233306 |
| Molecular Formula | C24H22F3N3O2S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanyl-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1CCC1=CCCCC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C24H22F3N3O2S/c25-17-10-11-19(22(27)21(17)26)28-20(31)14-33-24-29-18-9-5-4-8-16(18)23(32)30(24)13-12-15-6-2-1-3-7-15/h4-6,8-11H,1-3,7,12-14H2,(H,28,31) |
| InChIKey | KXOIMMUHYJQXDI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|