C23H22N4O2S2 — CID 3688882
N-(3-cyanothiophen-2-yl)-2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 3688882) has the molecular formula C23H22N4O2S2 and a molecular weight of 450.59 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 3688882 |
| Molecular Formula | C23H22N4O2S2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | N#Cc1ccsc1NC(=O)CSc1nc2ccccc2c(=O)n1CCC1=CCCCC1 |
| InChI | InChI=1S/C23H22N4O2S2/c24-14-17-11-13-30-21(17)26-20(28)15-31-23-25-19-9-5-4-8-18(19)22(29)27(23)12-10-16-6-2-1-3-7-16/h4-6,8-9,11,13H,1-3,7,10,12,15H2,(H,26,28) |
| InChIKey | GJHKTUOFUSHNLK-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|