C25H24N4O2S — CID 112787215
N-(4-cyanophenyl)-2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 112787215) has the molecular formula C25H24N4O2S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(4-cyanophenyl)-2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 112787215 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-(4-cyanophenyl)-2-[3-[2-(cyclohexen-1-yl)ethyl]-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | N#Cc1ccc(NC(=O)CSc2nc3ccccc3c(=O)n2CCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C25H24N4O2S/c26-16-19-10-12-20(13-11-19)27-23(30)17-32-25-28-22-9-5-4-8-21(22)24(31)29(25)15-14-18-6-2-1-3-7-18/h4-6,8-13H,1-3,7,14-15,17H2,(H,27,30) |
| InChIKey | LNIUEGJWYLRAFR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|